For research use only. Not for therapeutic Use.
1-(4-Methoxyphenyl)acetophenone is a versatile organic compound widely used in pharmaceuticals and chemical synthesis. This aromatic ketone features a methoxy group and is characterized by its role as an intermediate in the production of various agrochemicals and fine chemicals. Its unique structure allows for significant reactivity, making it valuable in diverse applications, including as a building block in the synthesis of biologically active molecules. Its stability and ease of handling further enhance its utility in research and development.
| CAS Number | 1023-17-2 |
| Synonyms | 1-(4-Methoxyphenyl)-2-phenyl-ethanone; 2-Phenyl-p-methoxyacetophenone; 4-Methoxy-α-phenylacetophenone; 4-Methoxydeoxybenzoin; Benzyl p-Methoxyphenyl Ketone; NSC 26658; p-Anisyl Benzyl Ketone; |
| Molecular Formula | C15H14O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-(4-methoxyphenyl)-2-phenylethanone |
| InChI | InChI=1S/C15H14O2/c1-17-14-9-7-13(8-10-14)15(16)11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| InChIKey | PLALKSRAHVYFOH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)CC2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |