Home
>
Chemical Reagents>Organic Building Blocks> 1-(4-Chlorophenyl)-2-methoxyethanamine hydrochloride
For research use only. Not for therapeutic Use.
1-(4-Chlorophenyl)-2-methoxyethanamine hydrochloride (Cat.No:L003963) is a vital chemical compound in pharmaceutical research. Its unique structure, featuring a chlorophenyl and methoxyethanamine motif, lends it significant pharmacological potential. This compound serves as a crucial intermediate in the synthesis of specialized pharmaceutical agents, particularly in the development of novel drugs.
| CAS Number | 1820906-41-9 |
| Molecular Formula | C9H13Cl2NO |
| Purity | ≥95% |
| IUPAC Name | 1-(4-chlorophenyl)-2-methoxyethanamine;hydrochloride |
| InChI | InChI=1S/C9H12ClNO.ClH/c1-12-6-9(11)7-2-4-8(10)5-3-7;/h2-5,9H,6,11H2,1H3;1H |
| InChIKey | LVQQYJSSTLKYFW-UHFFFAOYSA-N |
| SMILES | COCC(C1=CC=C(C=C1)Cl)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |