For research use only. Not for therapeutic Use.
1-(4-Bromophenyl)butane-1,3-dione(CAT: L021102) is a high-purity aromatic diketone compound widely utilized in pharmaceutical research and organic synthesis. Featuring a 4-bromophenyl group attached to a butane-1,3-dione backbone, it serves as a crucial intermediate for synthesizing bioactive molecules, heterocyclic compounds, and small-molecule inhibitors. Its diketone structure allows for versatile reactivity in the development of enaminones, chelating agents, and functionalized materials. Known for its stability and utility, 1-(4-Bromophenyl)butane-1,3-dione supports precision synthesis in medicinal chemistry, agrochemical development, and material science, offering reliability in both academic and industrial research applications.
CAS Number | 4023-81-8 |
Molecular Formula | C10H9BrO2 |
Purity | ≥95% |
IUPAC Name | 1-(4-bromophenyl)butane-1,3-dione |
InChI | InChI=1S/C10H9BrO2/c1-7(12)6-10(13)8-2-4-9(11)5-3-8/h2-5H,6H2,1H3 |
InChIKey | GIKXMINIUUFRFD-UHFFFAOYSA-N |
SMILES | CC(=O)CC(=O)C1=CC=C(C=C1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |