For research use only. Not for therapeutic Use.
1-(4-(Benzyloxy)-2-hydroxy-6-methoxyphenyl)ethanone(Cat No.:L031707)is an aromatic compound with significant applications in pharmaceutical and chemical research. Featuring a phenyl ring substituted with benzyloxy, hydroxy, and methoxy groups, along with an ethanone moiety, this compound serves as a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its functional groups allow for diverse chemical modifications, making it valuable in the development of therapeutic agents and fine chemicals. Additionally, it is used in studies involving organic synthesis and reaction mechanisms.
| CAS Number | 39548-89-5 |
| Molecular Formula | C16H16O4 |
| Purity | ≥95% |
| IUPAC Name | 1-(2-hydroxy-6-methoxy-4-phenylmethoxyphenyl)ethanone |
| InChI | InChI=1S/C16H16O4/c1-11(17)16-14(18)8-13(9-15(16)19-2)20-10-12-6-4-3-5-7-12/h3-9,18H,10H2,1-2H3 |
| InChIKey | YVPCAMMHRRDWFI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1OC)OCC2=CC=CC=C2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |