For research use only. Not for therapeutic Use.
1-(3,4-Difluoro-2-hydroxyphenyl)ethanone(Cat No.:L026674)is a chemical compound that features a hydroxy group and two fluorine atoms on a phenyl ring, attached to an ethanone group. This structure imparts unique electronic properties due to the electronegativity of the fluorine atoms, enhancing the compound’s reactivity and stability. The hydroxy group provides potential for further functionalization and increases solubility in polar solvents, making it useful in various chemical syntheses. This compound is particularly valuable in pharmaceutical development, where it serves as a precursor in the synthesis of complex molecules for drug discovery, targeting diverse therapeutic areas.
| CAS Number | 816450-98-3 |
| Molecular Formula | C8H6F2O2 |
| Purity | ≥95% |
| IUPAC Name | 1-(3,4-difluoro-2-hydroxyphenyl)ethanone |
| InChI | InChI=1S/C8H6F2O2/c1-4(11)5-2-3-6(9)7(10)8(5)12/h2-3,12H,1H3 |
| InChIKey | NGHOATHDUMGWQN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)F)F)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |