For research use only. Not for therapeutic Use.
1-(3-Chloropyridin-2-yl)ethanol(Cat No.:L010029)is a versatile organic compound frequently utilized in pharmaceutical research and chemical synthesis. This compound, characterized by a chlorinated pyridine ring attached to an ethanol group, serves as a critical intermediate in the development of various therapeutic agents. Its unique structure allows for diverse chemical modifications, making it valuable in the synthesis of complex molecules. With its role in medicinal chemistry, 1-(3-Chloropyridin-2-yl)ethanol is essential for advancing drug discovery and development, ensuring high precision and effectiveness in research applications.
| CAS Number | 1269430-33-2 |
| Molecular Formula | C7H8ClNO |
| Purity | ≥95% |
| IUPAC Name | 1-(3-chloropyridin-2-yl)ethanol |
| InChI | InChI=1S/C7H8ClNO/c1-5(10)7-6(8)3-2-4-9-7/h2-5,10H,1H3 |
| InChIKey | GWGFQCVQIVYJJS-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC=N1)Cl)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |