Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-((3-Bromo-4-ethoxyphenyl)sulfonyl)-4-methylpiperazine
For research use only. Not for therapeutic Use.
1-((3-Bromo-4-ethoxyphenyl)sulfonyl)-4-methylpiperazine(Cat No.:L032222)is a complex organic compound featuring a piperazine ring substituted with a methyl group and a sulfonyl group attached to a brominated ethoxyphenyl moiety. This compound is significant in medicinal chemistry, where it serves as a key intermediate in the synthesis of pharmaceutical agents. The combination of bromine, ethoxy, and sulfonyl groups allows for selective modifications and enhances the compound’s reactivity, making it valuable for developing bioactive molecules. Its role in drug discovery underscores its importance in creating novel therapeutic agents.
CAS Number | 1093065-11-2 |
Molecular Formula | C13H19BrN2O3S |
Purity | ≥95% |
IUPAC Name | 1-(3-bromo-4-ethoxyphenyl)sulfonyl-4-methylpiperazine |
InChI | InChI=1S/C13H19BrN2O3S/c1-3-19-13-5-4-11(10-12(13)14)20(17,18)16-8-6-15(2)7-9-16/h4-5,10H,3,6-9H2,1-2H3 |
InChIKey | GGBSHXKOKQKKGX-UHFFFAOYSA-N |
SMILES | CCOC1=C(C=C(C=C1)S(=O)(=O)N2CCN(CC2)C)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |