Home
>
Catalysts and Ligands>Chiral phosphine ligands> [1-(2R,5R)-2,5-Diethylphospholanyl]-[2-(2R,5R)-2,5-diethylphospholanyl-1-oxide]benzene
For research use only. Not for therapeutic Use.
[1-(2R,5R)-2,5-Diethylphospholanyl]-[2-(2R,5R)-2,5-diethylphospholanyl-1-oxide]benzene is a complex organic compound featuring two phospholanyl groups (phosphorus-containing heterocyclic rings) attached to a benzene ring. Each phospholanyl group is substituted with ethyl groups at the 2- and 5-positions and has a chiral configuration (2R,5R). The second phospholanyl group is further oxidized at the 1-position, forming a phospholanyl-oxide. This compound likely has applications in advanced materials chemistry, catalysis, or as a ligand in coordination chemistry, given its unique structure and functional groups.
| CAS Number | 924294-55-3 |
| Molecular Formula | C22H36OP2 |
| Purity | ≥95% |
| IUPAC Name | (2R,5R)-1-[2-[(2R,5R)-2,5-diethylphospholan-1-yl]phenyl]-2,5-diethyl-1位5-phospholane 1-oxide |
| InChI | InChI=1S/C22H36OP2/c1-5-17-13-14-18(6-2)24(17)21-11-9-10-12-22(21)25(23)19(7-3)15-16-20(25)8-4/h9-12,17-20H,5-8,13-16H2,1-4H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | PFNSFIIPVBDTTF-UAFMIMERSA-N |
| SMILES | CC[C@@H]1CC[C@H](P1C2=CC=CC=C2P3(=O)[C@@H](CC[C@H]3CC)CC)CC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |