For research use only. Not for therapeutic Use.
1-(2,4-Dimethylphenyl)piperazine is an organic compound featuring a piperazine ring substituted with a 2,4-dimethylphenyl group. This compound is of interest in medicinal chemistry due to its potential pharmacological activities, including anxiolytic and antidepressant effects. The piperazine structure allows for interactions with various neurotransmitter receptors, making it a valuable scaffold for drug development. Researchers explore its applications in synthesizing novel therapeutic agents targeting central nervous system disorders, as well as its mechanisms of action in modulating neurotransmitter systems.
| CAS Number | 1013-76-9 |
| Molecular Formula | C12H18N2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-(2,4-dimethylphenyl)piperazine |
| InChI | InChI=1S/C12H18N2/c1-10-3-4-12(11(2)9-10)14-7-5-13-6-8-14/h3-4,9,13H,5-8H2,1-2H3 |
| InChIKey | RUIMBVCRNZHCRQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2CCNCC2)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |