Home
>
Inhibitors/Agonists>Anti-infection>DNA/RNA Synthesis>
>
1-(((2-Hydroxyphenyl)imino)methyl)-2-naphthol
1-(((2-Hydroxyphenyl)imino)methyl)-2-naphthol(CAT: L009838), a naphthol derivative with an imine group and a hydroxyphenyl substituent, holds significance in pharmaceutical and organic chemistry. Its aromatic structure and functional groups suggest potential interactions with biological targets, making it relevant for drug development. In pharmaceutical research, it could be explored for its effects on enzyme inhibition or receptor interactions, potentially impacting therapeutic pathways. The imine and hydroxyphenyl groups offer opportunities for chemical modifications, important for fine-tuning properties or creating derivatives.
Catalog Number | L009838 |
CAS Number | 138736-73-9 |
Molecular Formula | C17H13NO2 |
Purity | 95% |
IUPAC Name | 1-[(2-hydroxyphenyl)iminomethyl]naphthalen-2-ol |
InChI | InChI=1S/C17H13NO2/c19-16-10-9-12-5-1-2-6-13(12)14(16)11-18-15-7-3-4-8-17(15)20/h1-11,19-20H |
InChIKey | FMIVOPRNBGRDKP-UHFFFAOYSA-N |