1-[(2-Chlorophenyl)(methylimino)methyl]cyclopentanol is an organic compound featuring a cyclopentanol core with a 2-chlorophenyl and a methylimino group. This structure makes it useful in medicinal chemistry and pharmaceutical research. The compound’s unique functional groups allow it to interact with various biological targets, making it a potential candidate for developing new therapeutic agents. Its synthesis and study contribute to understanding structure-activity relationships in drug development.
| Catalog Number | R044829 |
| CAS Number | 6740-87-0 |
| Synonyms | USP Ketamine Related Compound A; |
| Molecular Formula | C13H16ClNO |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 1-[C-(2-chlorophenyl)-N-methylcarbonimidoyl]cyclopentan-1-ol |
| InChI | InChI=1S/C13H16ClNO/c1-15-12(13(16)8-4-5-9-13)10-6-2-3-7-11(10)14/h2-3,6-7,16H,4-5,8-9H2,1H3 |
| InChIKey | FJGPXUPMNZOTLX-UHFFFAOYSA-N |
| SMILES | CN=C(C1=CC=CC=C1Cl)C2(CCCC2)O |
