For research use only. Not for therapeutic Use.
6-Chloro-1H-pyrazolo[4,3-c]pyridin-3-ol (Cat.No:L003503) is a notable heterocyclic compound with versatile applications in medicinal chemistry. Its distinct structure and reactivity make it a valuable scaffold for the development of novel pharmaceuticals. This compound has garnered attention for its potential as a key component in the synthesis of bioactive molecules, underscoring its significance in modern drug discovery endeavors.
CAS Number | 73129-52-9 |
Molecular Formula | C9H9ClO |
Purity | ≥95% |
IUPAC Name | 1-(2-chloro-5-methylphenyl)ethanone |
InChI | InChI=1S/C9H9ClO/c1-6-3-4-9(10)8(5-6)7(2)11/h3-5H,1-2H3 |
InChIKey | OYXIUVGNYBMJMD-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1)Cl)C(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |