For research use only. Not for therapeutic Use.
0990CL（Cat No.:I012892）is a small-molecule research compound investigated for its potential role in modulating cancer-related signaling pathways. Preclinical studies suggest it may interfere with oncogenic protein interactions and survival mechanisms, thereby reducing tumor cell proliferation and promoting apoptosis. While its precise molecular target remains under characterization, 0990CL has been explored in oncology research as a chemical probe to identify novel therapeutic strategies. It serves as a useful tool for studying tumor biology, resistance mechanisms, and drug development approaches in molecular pharmacology and cancer research.
| CAS Number | 511514-03-7 |
| Synonyms | 4-phenyl-N-(4,4,6-trimethyl-1H-pyrimidin-2-yl)quinazolin-2-amine |
| Molecular Formula | C21H21N5 |
| Purity | ≥95% |
| IUPAC Name | 4-phenyl-N-(4,4,6-trimethyl-1H-pyrimidin-2-yl)quinazolin-2-amine |
| InChI | InChI=1S/C21H21N5/c1-14-13-21(2,3)26-20(22-14)25-19-23-17-12-8-7-11-16(17)18(24-19)15-9-5-4-6-10-15/h4-13H,1-3H3,(H2,22,23,24,25,26) |
| InChIKey | DXICUHJLOMNKOU-UHFFFAOYSA-N |
| SMILES | CC1=CC(N=C(N1)NC2=NC3=CC=CC=C3C(=N2)C4=CC=CC=C4)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
