For research use only. Not for therapeutic Use.
γ-Tocopherol-d4(Cat No.:S000561) is a specialized form of γ-tocopherol, a natural form of vitamin E with antioxidant properties beneficial for cellular health. The “d4” designation indicates that four hydrogen atoms in the γ-tocopherol molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic substitution facilitates precise tracking of γ-tocopherol metabolism and its distribution in biological systems using advanced analytical techniques like mass spectrometry. γ-Tocopherol-d4 serves as a valuable tool in pharmacokinetic studies, aiding in elucidating vitamin E metabolism, understanding its bioavailability, and investigating its role in mitigating oxidative stress-related diseases.
| CAS Number | 1329652-13-2 |
| Molecular Formula | C28H44D4O2 |
| Purity | ≥95% |
| IUPAC Name | (2R)-5-deuterio-2,8-dimethyl-7-(trideuteriomethyl)-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol |
| InChI | InChI=1S/C28H48O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28/h19-22,29H,8-18H2,1-7H3/t21-,22-,28-/m1/s1/i5D3,19D |
| InChIKey | QUEDXNHFTDJVIY-HYPXHKDHSA-N |
| SMILES | CC1=C(C=C2CCC(OC2=C1C)(C)CCCC(C)CCCC(C)CCCC(C)C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |