For research use only. Not for therapeutic Use.
| CAS Number | 582-22-9 |
| Synonyms | (RS)-2-Phenylpropylamine; (±)-2-Phenylpropylamine; (±)-β-Methylphenethylamine; 2-Phenyl-1-propanamine; 2-Phenyl-1-propylamine; 2-Phenylpropanamine; 2-Phenylpropylamine; NSC 272273; β-Methylbenzeneethanamine; β-Methylphenylethylamine; β-Phenylpropylam |
| Molecular Formula | C9H13N |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-phenylpropan-1-amine |
| InChI | InChI=1S/C9H13N/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3 |
| InChIKey | AXORVIZLPOGIRG-UHFFFAOYSA-N |
| SMILES | CC(CN)C1=CC=CC=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |