For research use only. Not for therapeutic Use.
β-bisabolol (Cat.No:M076459) is a natural monocyclic sesquiterpene alcohol, derived from chamomile. It possesses anti-inflammatory, antimicrobial, and skin-soothing properties. Widely used in cosmetics and skincare products, β-bisabolol aids in skin healing, making it a popular ingredient in formulations targeting sensitive or irritated skin.
| CAS Number | 15352-77-9 |
| Synonyms | (1S)-1-[(1S)-1,5-dimethyl-4-hexenyl]-4-methyl-3-cyclohexen-1-ol,β-bisabolol |
| Molecular Formula | C15H26O |
| Purity | 95% |
| Appearance | Colourless Oil |
| Storage | -20°C |
| Analysis method | TLC |
| IUPAC Name | 4-methyl-1-(6-methylhept-5-en-2-yl)cyclohex-3-en-1-ol |
| InChI | InChI=1S/C15H26O/c1-12(2)6-5-7-14(4)15(16)10-8-13(3)9-11-15/h6,8,14,16H,5,7,9-11H2,1-4H3 |
| InChIKey | WTVHAMTYZJGJLJ-UHFFFAOYSA-N |
| SMILES | CC1=CCC(CC1)(C(C)CCC=C(C)C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |