For research use only. Not for therapeutic Use.
3,4-Methylenedioxyamphetamine (MDA; Item Nos. <span class=/itemid/>ISO60189</span> | <span class=/itemid/>11554</span>) is a psychedelic drug that is regulated in the United States. MDA 2-aldoxime analog is an intermediate produced in the synthesis of MDA from helional (also known as ocean propanal, aquanal, or tropional). The physiological and toxicological properties of this compound are not known. This product is intended for forensic and research applications.
| CAS Number | 146322-08-9 |
| Synonyms | 3-(1,3-Benzodioxol-5-yl)-2-methylpropionaldoxime |
| Molecular Formula | C11H13NO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (NE)-N-[3-(1,3-benzodioxol-5-yl)-2-methylpropylidene]hydroxylamine |
| InChI | InChI=1S/C11H13NO3/c1-8(6-12-13)4-9-2-3-10-11(5-9)15-7-14-10/h2-3,5-6,8,13H,4,7H2,1H3/b12-6+ |
| InChIKey | ISLHQWBNLXYVQG-WUXMJOGZSA-N |
| SMILES | CC(CC1=CC2=C(C=C1)OCO2)C=NO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |