For research use only. Not for therapeutic Use.
| CAS Number | 2882-19-1 |
| Synonyms | 2-Bromo-2-phenylacetic Acid Ethyl Ester; DL-α-Bromophenylacetic Acid Ethyl Ester; Ethyl (±)-α-Bromobenzeneacetate; Ethyl (±)-α-Bromophenylacetate; Ethyl 2-Bromo-2-phenylacetate; Ethyl 2-Bromophenylacetate; Ethyl Bromophenylacetate; Ethyl α-Bromo-α-ph |
| Molecular Formula | C10H11BrO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | ethyl 2-bromo-2-phenylacetate |
| InChI | InChI=1S/C10H11BrO2/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3 |
| InChIKey | BKTKLDMYHTUESO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC=C1)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |