For research use only. Not for therapeutic Use.
(±)-Vesamicol hydrochloride（Cat No.:M024382）is a potent inhibitor of the vesicular acetylcholine transporter (VAChT), preventing acetylcholine uptake into synaptic vesicles. This leads to a reduction in cholinergic neurotransmission, making it a valuable tool in neurochemical research. As a racemic mixture, (±)-vesamicol is often used to study cholinergic dysfunction in neurodegenerative diseases like Alzheimer’s and Parkinson’s. It also plays a role in imaging studies targeting VAChT with PET tracers. The hydrochloride salt form enhances solubility and stability for experimental use in both in vitro and in vivo studies.
| CAS Number | 120447-62-3 |
| Synonyms | (1R,2R)-2-(4-phenylpiperidin-1-yl)cyclohexan-1-ol;hydrochloride |
| Molecular Formula | C17H26ClNO |
| Purity | ≥95% |
| IUPAC Name | 2-(4-phenylpiperidin-1-yl)cyclohexan-1-ol;hydrochloride |
| InChI | InChI=1S/C17H25NO.ClH/c19-17-9-5-4-8-16(17)18-12-10-15(11-13-18)14-6-2-1-3-7-14;/h1-3,6-7,15-17,19H,4-5,8-13H2;1H |
| InChIKey | XJNUHVMJVWOYCW-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)N2CCC(CC2)C3=CC=CC=C3)O.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
