δ-Guanido-α-ketovaleric acid(Cat No.:R035600)is an important intermediate in the metabolism of arginine and proline. Structurally, it features a guanidino group and a keto group on a five-carbon backbone, playing a pivotal role in various biochemical pathways. This compound is involved in the urea cycle and the synthesis of creatine, crucial for energy storage in muscle cells. Its metabolic significance extends to nitrogen balance and amino acid synthesis. Research into δ-Guanido-α-ketovaleric acid aids in understanding metabolic disorders and developing therapeutic strategies for related conditions.
Catalog Number | R035600 |
CAS Number | 3715-10-4 |
Synonyms | 5-Guanidino-2-oxo-valeric Acid; 5-[(Aminoiminomethyl)amino]-2-oxopentanoic Acid; 2-Oxo-5-guanidinovaleric Acid; 5-Guanidino-2-oxovaleric Acid; α-Keto-δ-guanidinovaleric Acid; δ-Guanidino-α-oxovaleric Acid; ? |
Molecular Formula | C6H11N3O3 |
Purity | 95% |
Storage | Store at -20C |
IUPAC Name | 5-(diaminomethylideneamino)-2-oxopentanoic acid |
InChI | InChI=1S/C6H11N3O3/c7-6(8)9-3-1-2-4(10)5(11)12/h1-3H2,(H,11,12)(H4,7,8,9) |
InChIKey | ARBHXJXXVVHMET-UHFFFAOYSA-N |
SMILES | C(CC(=O)C(=O)O)CN=C(N)N |