β-Selinene（Cat No.:M084541） is a sesquiterpene, a type of naturally occurring organic compound that forms an essential part of many plant essential oils. Characterized by a complex cyclic structure, β-selinene is particularly noted for its aromatic and woody fragrance, making it a valued component in the perfume industry. Beyond its olfactory appeal, β-selinene has been studied for potential anti-inflammatory and anticancer properties. It is found in a variety of plants including celery, from which it derives its name, highlighting its role in the flavor profiles of these plants as well.
| Catalog Number | M084541 |
| CAS Number | 17066-67-0 |
| Molecular Formula | C15H24 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (3R,4aS,8aR)-8a-methyl-5-methylidene-3-prop-1-en-2-yl-1,2,3,4,4a,6,7,8-octahydronaphthalene |
| InChI | InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h13-14H,1,3,5-10H2,2,4H3/t13-,14+,15-/m1/s1 |
| InChIKey | YOVSPTNQHMDJAG-QLFBSQMISA-N |
| SMILES | CC(=C)C1CCC2(CCCC(=C)C2C1)C |
