β-Phellandrene(Cat No.:R024083)is a naturally occurring monoterpene found in various essential oils, including those of eucalyptus, lavender, and peppermint. Known for its distinctive peppery, citrus aroma, it is widely used in the fragrance and flavor industries to impart fresh, invigorating scents and tastes. Additionally, β-Phellandrene exhibits potential therapeutic properties, including antimicrobial, antifungal, and anti-inflammatory effects, making it a subject of interest in medicinal research. Its high purity is crucial for ensuring consistent quality in both commercial products and scientific studies, contributing to advancements in natural health and wellness applications.
Catalog Number | R024083 |
CAS Number | 555-10-2 |
Synonyms | 3-Methylene-6-(1-methylethyl)cyclohexene; p-Mentha-1(7),2-diene; (±)-β-Phellandrene; 3-Isopropyl-6-methylene-1-cyclohexene; 4-Isopropyl-1-methylene-2-cyclohexene; NSC 53044; beta-Phellandrene |
Molecular Formula | C10H16 |
Purity | 95% |
Storage | Desiccate at RT |
IUPAC Name | 3-methylidene-6-propan-2-ylcyclohexene |
InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8,10H,3,5,7H2,1-2H3 |
InChIKey | LFJQCDVYDGGFCH-UHFFFAOYSA-N |
SMILES | CC(C)C1CCC(=C)C=C1 |