β-Formylpropionic Acid is a high-purity compound essential for advanced pharmaceutical and biochemical research. This carboxylic acid derivative is crucial for studies involving organic synthesis, metabolic pathways, and enzyme reactions. Known for its stability and reactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in diverse scientific applications.
| Catalog Number | R021364 |
| CAS Number | 692-29-5 |
| Synonyms | 3-Formylpropanoic Acid; 3-Formylpropionic Acid; 4-Oxobutanoic acid; 4-Oxobutyric acid; Butyraldehydic Acid; 3-Formylpropanoic Acid; Succinic Acid Semialdehyde; Succinic Semialdehyde; γ-Oxybutyric Acid |
| Molecular Formula | C4H6O3 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 4-oxobutanoic acid |
| InChI | InChI=1S/C4H6O3/c5-3-1-2-4(6)7/h3H,1-2H2,(H,6,7) |
| InChIKey | UIUJIQZEACWQSV-UHFFFAOYSA-N |
| SMILES | C(CC(=O)O)C=O |
