β-Butyrolactone(CAT: R025709) is a versatile compound with significance in pharmaceutical, organic chemistry, and material chemistry. It acts as a crucial precursor in the synthesis of pharmaceuticals, particularly in the production of compounds like γ-hydroxybutyric acid (GHB), a sedative used in medicine. In organic chemistry, it serves as a valuable solvent for various reactions and polymerization processes.
| Catalog Number | R025709 |
| CAS Number | 3068-88-0 |
| Synonyms | 3-Hydroxybutyric Acid β-Lactone; β-Hydroxybutyric Acid Lactone; (RS)-β-Butyrolactone; (±)-β-Butyrolactone; (±)-β-Methylpropiolactone; 3-Hydroxybutyric Acid Lactone; 4-Methyl-2-oxetanone; 3-Hydroxybutanoic Acid β-Lactone; DL-β-Butyrolactone; rac-β-Bu |
| Molecular Formula | C4H6O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-methyloxetan-2-one |
| InChI | InChI=1S/C4H6O2/c1-3-2-4(5)6-3/h3H,2H2,1H3 |
| InChIKey | GSCLMSFRWBPUSK-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)O1 |
