α-Farnesene is a naturally occurring sesquiterpene hydrocarbon found in various plants, particularly in apples and other fruits. It serves as a key component of fruit aroma and flavor, contributing to their characteristic scent. Additionally, α-farnesene has been investigated for its potential insecticidal properties, making it valuable in agriculture for pest management. Its diverse biological activities make it a subject of interest in both food and pharmaceutical industries.
| Catalog Number | R030247 |
| CAS Number | 502-61-4 |
| Synonyms | (E,E)-3,7,11-Trimethyl-1,3,6,10-dodecatetraene; Farnesene; (3E,6E)-α-Farnesene; (E,E)-α-Farnesene; alpha-Farnesene; trans,trans-α-Farnesene; trans-2,6,10-Trimethyl-2,6,9,11-dodecatetraene; trans-3,7,11-Trimethyl-1,3,6,10-dodecatetraene; trans-α-Farne |
| Molecular Formula | C15H24 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (3E,6E)-3,7,11-trimethyldodeca-1,3,6,10-tetraene |
| InChI | InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9-10,12H,1,7-8,11H2,2-5H3/b14-10+,15-12+ |
| InChIKey | CXENHBSYCFFKJS-VDQVFBMKSA-N |
| SMILES | CC(=CCCC(=CCC=C(C)C=C)C)C |
