α-Farnesene(Cat No.:R030247)is a naturally occurring sesquiterpene found in the essential oils of various plants, particularly in the peels of green apples and other fruits. It plays a significant role in plant defense mechanisms against pests and pathogens. In agriculture, α-Farnesene is studied for its potential as a natural pesticide and its role in fruit ripening and storage. Additionally, it has applications in the fragrance and flavor industries due to its pleasant, fruity aroma. Its versatility and biological importance make α-Farnesene a valuable compound in both scientific research and commercial applications.
Catalog Number | R030247 |
CAS Number | 502-61-4 |
Synonyms | (E,E)-3,7,11-Trimethyl-1,3,6,10-dodecatetraene; Farnesene; (3E,6E)-α-Farnesene; (E,E)-α-Farnesene; alpha-Farnesene; trans,trans-α-Farnesene; trans-2,6,10-Trimethyl-2,6,9,11-dodecatetraene; trans-3,7,11-Trimethyl-1,3,6,10-dodecatetraene; trans-α-Farne |
Molecular Formula | C15H24 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (3E,6E)-3,7,11-trimethyldodeca-1,3,6,10-tetraene |
InChI | InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9-10,12H,1,7-8,11H2,2-5H3/b14-10+,15-12+ |
InChIKey | CXENHBSYCFFKJS-VDQVFBMKSA-N |
SMILES | CC(=CCCC(=CCC=C(C)C=C)C)C |