(±)-Methionine (Cat.No:R061698) is an essential amino acid found in dietary proteins. It plays a vital role in protein synthesis, methylation, and metabolism. Methionine contributes to various physiological functions, including tissue repair, antioxidant defense, and neurotransmitter synthesis. It serves as a building block for proteins and is important for overall health.
Catalog Number | R061698 |
CAS Number | 59-51-8 |
Synonyms | Acimetion; Amurex; Banthionine; Cynaron; DL-2-Amino-4-(methylthio)butyric Acid; Dyprin; Lactet; Lobamine; Meonine; Meprom M 85; MetAMINO; Methilanin; MetiPEARL; Metione; NSC 9241; Neston; Pedameth; Racemethionine; Rhodimet NP 99; Smartamine; Smartami |
Molecular Formula | C5H11NO2S |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 2-amino-4-methylsulfanylbutanoic acid |
InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
InChIKey | FFEARJCKVFRZRR-UHFFFAOYSA-N |
SMILES | CSCCC(C(=O)O)N |