For research use only. Not for therapeutic Use.
(±)-2-Bromobutyric Acid (Cat No.:R030671) is an organic compound with the formula C4H7BrO2. It consists of a four-carbon chain with a bromine atom and a carboxylic acid group. As a racemic mixture, it contains both left- and right-handed versions. It’s used in chemical synthesis, pharmaceuticals, and research. Its diverse applications stem from its reactivity and ability to introduce bromine and carboxylic acid functionalities.
| CAS Number | 80-58-0 |
| Synonyms | (RS)-2-Bromobutyric Acid; (RS)-α-Bromobutyric Acid; (±)-2-Bromobutanoic Acid; (±)-α-Bromobutanoic Acid; 2-Bromobutanoic Acid; 2-Bromobutyric Acid; DL-2-Bromo-n-butyric Acid; DL-α-Bromobutyric Acid; NSC 8024; α-Bromo-n-butyric Acid; α-Bromobutyric Aci |
| Molecular Formula | C4H7BrO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-bromobutanoic acid |
| InChI | InChI=1S/C4H7BrO2/c1-2-3(5)4(6)7/h3H,2H2,1H3,(H,6,7) |
| InChIKey | YAQLSKVCTLCIIE-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)O)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |