2-Aminoquinoline(CAT: R065665) is an aromatic amine compound belonging to the quinoline family. Its mode of action involves being an important building block in organic synthesis and pharmaceutical research. Pharmacologically, 2-Aminoquinoline is not used as a therapeutic drug in itself. Instead, it is utilized in the development of various pharmaceutical compounds, including antimalarial drugs, antiviral agents, and anticancer medications. Its unique structure makes it a valuable intermediate for preparing diverse molecules with potential biological activities.
| Catalog Number | R065665 |
| CAS Number | 580-22-3 |
| Molecular Formula | C9H8N2 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | quinolin-2-amine |
| InChI | InChI=1S/C9H8N2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H,(H2,10,11) |
| InChIKey | GCMNJUJAKQGROZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)N |
