Sodium Fluoroacetate(CAT: R068230) is a highly toxic compound primarily used as a pesticide for controlling invasive mammals and pests. Known for its potent inhibitory effects on the citric acid cycle, it disrupts cellular energy production, leading to rapid physiological decline in targeted species. Due to its high toxicity, Sodium Fluoroacetate is strictly regulated and handled with extreme care in controlled environments. In research, it is utilized for studying metabolic pathways, particularly in investigations related to enzyme inhibition and toxicology. This compound is of significant interest to researchers focused on understanding the biochemical mechanisms of toxicity and developing strategies for mitigating its environmental impact.
| Catalog Number | R068230 |
| CAS Number | 62-74-8 |
| Molecular Formula | C2H2FO2.Na |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | sodium;2-fluoroacetate |
| InChI | InChI=1S/C2H3FO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| InChIKey | JGFYQVQAXANWJU-UHFFFAOYSA-M |
| SMILES | C(C(=O)[O-])F.[Na+] |
