Phosphorus sesquisulfide(Cat No.:M047217), with the chemical formula P4S3, is a dark red or orange crystalline solid that is one of the lesser-known phosphorus sulfides. It is primarily used in the production of safety matches and in certain pesticide formulations. Phosphorus sesquisulfide is preferred in safety match heads because it ignites only under specific conditions, such as when struck against a specially prepared surface, making it safer than white phosphorus. The compound is also of interest in materials science for its semiconductor properties and potential applications in electronic and optical devices.
Catalog Number | M047217 |
CAS Number | 1314-85-8 |
Molecular Formula | P4S3 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 3,5,7-trithia-1,2,4,6-tetraphosphatricyclo[2.2.1.02,6]heptane |
InChI | InChI=1S/P4S3/c5-1-2-3(1)7-4(5)6-2 |
InChIKey | RWQFRHVDPXXRQN-UHFFFAOYSA-N |
SMILES | P12P3P1SP(S2)S3 |