Isobutylamido thiazolyl resorcinol(CAT: L000380) is a compound with substantial applications in the pharmaceutical and organic chemistry domains. This chemical is valuable in the development of pharmaceutical agents, particularly in the field of dermatology. It is used for its potential as a melanin synthesis inhibitor, making it a key component in the formulation of skin-lightening or anti-pigmentation products.
| Catalog Number | L000380 |
| CAS Number | 1428450-95-6 |
| Molecular Formula | C13H14N2O3S |
| Purity | 97% |
| IUPAC Name | N-[4-(2,4-dihydroxyphenyl)-1,3-thiazol-2-yl]-2-methylpropanamide |
| InChI | InChI=1S/C13H14N2O3S/c1-7(2)12(18)15-13-14-10(6-19-13)9-4-3-8(16)5-11(9)17/h3-7,16-17H,1-2H3,(H,14,15,18) |
| InChIKey | WIDNAJNXDPHROL-UHFFFAOYSA-N |
| Documentation | CoA |
