Diphenic acid - CAS 482-05-3
Diphenic acid (Cat. No: R070553) has the chemical reactivity of aromatic diacids, which can produce anhydrides, esters, imides, amides, and oxychlorides. Diphenic acid can be used as a pharmaceutical intermediate for the preparation of chemical materials.
Catalog Number: R070553
CAS Number: 482-05-3
PubChem Substance ID:355162505
Molecular Formula: C14H10O4
Molecular Weight:242.23
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Synonym
Synonyms | [1.1-Biphenyl]-2-2-dicarboxylic acid |
---|
Property
Molecular Formula: | C14H10O4 |
---|---|
Molecular Weight | 242.23 |
Purity | ≥95% |
Storage | RT |
Computed Descriptor
IUPAC Name | 2-(2-carboxyphenyl)benzoic acid |
---|---|
InChI | InChI=1S/C14H10O4/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18/h1-8H,(H,15,16)(H,17,18) |
InChIKey | GWZCCUDJHOGOSO-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2C(=O)O)C(=O)O |