Dimethyliodoarsine - CAS 676-75-5
Dimethyliodoarsine(CAT: R054940) is an organoarsenic compound. Its mode of action and pharmacological effects can involve its interactions with biological molecules and cellular processes due to its specific chemical structure. Dimethyliodoarsine is not widely studied or recognized for specific pharmacological actions or applications. However, organoarsenic compounds like dimethyliodoarsine have been investigated for their potential uses in fields such as organic synthesis, materials science, or coordination chemistry.
Catalog Number: R054940
CAS Number: 676-75-5
PubChem Substance ID:355162325
Molecular Formula: C2H6AsI
Molecular Weight:231.896
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Synonym
Synonyms | Dimethylarsine iodide; Dimethylarsinous iodide; Dimethyliodoarsine; Iododimethylarsine; DMA-I |
---|
Property
Molecular Formula: | C2H6AsI |
---|---|
Molecular Weight | 231.896 |
Purity | ≥95% |
Storage | Store at RT |
Computed Descriptor
IUPAC Name | iodo(dimethyl)arsane |
---|---|
InChI | InChI=1S/C2H6AsI/c1-3(2)4/h1-2H3 |
InChIKey | JHQSGZOIIRXESF-UHFFFAOYSA-N |
SMILES | C[As](C)I |