D(-)-Quinic Acid is a naturally occurring compound used in pharmaceutical and biochemical research. It serves as a key intermediate in the biosynthesis of aromatic compounds and is essential for studying metabolic pathways and antioxidant properties. This compound ensures precise and reliable results in advanced research on natural products, drug development, and metabolic processes.
| Catalog Number | R015846 |
| CAS Number | 77-95-2 |
| Synonyms | D-Quinic Acid; Quinic Acid; (-)- Quinic Acid; [1R-(1α,3α,4α,5β)]-1,3,4,5-Tetrahydroxycyclohexanecarboxylic Acid; (1α,3R,4α,5R)-1,3,4,5-Tetrahydroxycyclohexanecarboxylic Acid; |
| Molecular Formula | C7H12O6 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid |
| InChI | InChI=1S/C7H12O6/c8-3-1-7(13,6(11)12)2-4(9)5(3)10/h3-5,8-10,13H,1-2H2,(H,11,12)/t3-,4-,5?,7?/m1/s1 |
| InChIKey | AAWZDTNXLSGCEK-LNVDRNJUSA-N |
| SMILES | C1C(C(C(CC1(C(=O)O)O)O)O)O |
