Althiazide - CAS 5588-16-9
Althiazide (Cat.No:R048093) is a thiazide diuretic, commonly prescribed to manage hypertension and edema. It works by promoting diuresis, reducing excess fluid in the body. Althiazide’s mechanism involves inhibiting sodium reabsorption in the distal tubules of the kidneys, leading to increased urine production and decreased blood volume.
Catalog Number: R048093
CAS Number: 5588-16-9
PubChem Substance ID:355143901
Molecular Formula: C11H14ClN3O4S3
Molecular Weight:383.88
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Synonym
Synonyms | 6-Chloro-3,4-dihydro-3-[(2-propen-1-ylthio)methyl]-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-Dioxide; 3-[(Allylthio)methyl]-6-chloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-Dioxide; Althizide; Altizid; Altizide; |
---|
Property
Molecular Formula: | C11H14ClN3O4S3 |
---|---|
Molecular Weight | 383.88 |
Purity | ≥95% |
Storage | Store at -20°C |
Computed Descriptor
IUPAC Name | 6-chloro-1,1-dioxo-3-(prop-2-enylsulfanylmethyl)-3,4-dihydro-2H-1$l^{6} |
---|---|
InChI | InChI=1S/C11H14ClN3O4S3/c1-2-3-20-6-11-14-8-4-7(12)9(21(13,16)17)5-10(8)22(18,19)15-11/h2,4-5,11,14-15H,1,3,6H2,(H2,13,16,17) |
InChIKey | VGLGVJVUHYTIIU-UHFFFAOYSA-N |
SMILES | C=CCSCC1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl |