Assay:≥98%
Appearance:A crystalline solid
| Cat No: | R016542 |
| Cas No: | 32233-40-2 |
| Product-Name: | (-)-Corey Lactone Diol |
| IUPAC Name: | (3aR,4S,5R,6aS)-5-hydroxy-4-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| InChI: | InChI=1S/C8H12O4/c9-3-5-4-1-8(11)12-7(4)2-6(5)10/h4-7,9-10H,1-3H2/t4-,5-,6-,7+/m1/s1 |
| InChIKey: | VYTZWRCSPHQSFX-GBNDHIKLSA-N |
| SMILES: | C1C(C(C2C1OC(=O)C2)CO)O |
Corey aldehyde is a versatile, hydroxy-lactone intermediate for the synthesis of prostaglandins and prostaglandin analogs. Prostaglandin derivatives with modifications in the α chain, the ω chain, or both, are readily accessible from this general intermediate. (−)-Corey lactone diol is simply the reduced version of Corey aldehyde, with alcohol groups at both C-11 and C-13. This allows the introduction of ω chain constituents via alternate chemistries, such as nucleophilic displacements.
Your information is safe with us.