(4-((1-Methylpiperidin-4-yl)oxy)phenyl)methanol - CAS 1782394-50-6
(4-((1-Methylpiperidin-4-yl)oxy)phenyl)methanol (Cat.No:L004359) is a pivotal compound in pharmaceutical research. Its unique structure, combining a piperidine and phenol motif, imparts valuable pharmacological properties. This compound serves as a crucial scaffold in the development of bioactive molecules, particularly in the field of medicinal chemistry. Its versatile reactivity and diverse applications underscore its importance in contemporary drug discovery, making it a significant candidate in the quest for novel therapeutic agents.
Catalog Number: L004359
CAS Number: 1782394-50-6
Molecular Formula: C13H19NO2
Molecular Weight:221.29
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Property
| Molecular Formula: | C13H19NO2 |
|---|---|
| Molecular Weight | 221.29 |
| Purity | ≥95% |
Computed Descriptor
| IUPAC Name | [4-(1-methylpiperidin-4-yl)oxyphenyl]methanol |
|---|---|
| InChI | InChI=1S/C13H19NO2/c1-14-8-6-13(7-9-14)16-12-4-2-11(10-15)3-5-12/h2-5,13,15H,6-10H2,1H3 |
| InChIKey | OZEVXRJEDMOBNK-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)OC2=CC=C(C=C2)CO |